CAS 2647464-91-1 appears in our catalog under these names: CXCR2 antagonist 2, CXCR2 antagonist 2, 99%, 99%, CXCR2 antagonist 2, 99.32%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25 mg, 50 mg, 10 mg, 10mM/1mL, 100 mg.
1-(3-fluoro-2-methylphenyl)-3-(8-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromen-7-yl)urea (CAS 2647464-91-1) is a chemical compound with the molecular formula C17H17FN2O4S and a molecular weight of 364.4 g/mol. IUPAC name: 1-(3-fluoro-2-methylphenyl)-3-(8-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromen-7-yl)urea. InChIKey: SBTIRQPCNMRDMN-UHFFFAOYSA-N.
| Molecular formula | C17H17FN2O4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1-(3-fluoro-2-methylphenyl)-3-(8-hydroxy-1,1-dioxo-3,4-dihydro-2H-thiochromen-7-yl)urea |
| InChIKey | SBTIRQPCNMRDMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1F)NC(=O)NC2=C(C3=C(CCCS3(=O)=O)C=C2)O |
Computed by PubChem (NCBI)