CAS 452972-13-3 appears in our catalog under these names: 5-Bromo-3-pyridineboronic acid pinacol ester, 5-Bromopyridine-3-boronic acid pinacol ester, 97%, 3-Bromo-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyridine, 97%, 97%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 50g, 100g, 1g, 5g, 10g, 25g, 100mg, 250mg.
3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 452972-13-3) is a chemical compound with the molecular formula C11H15BBrNO2 and a molecular weight of 283.96 g/mol. IUPAC name: 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: JSUVNRWVYRZAOS-UHFFFAOYSA-N.
| Molecular formula | C11H15BBrNO2 |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | JSUVNRWVYRZAOS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)