Products 2225173-82-8
CAS 2225173-82-8 is the registry number for 2–Bromo–6–(cyclohexyl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-bromo-6-cyclohexyl-4-pyridinyl)boronic acid (CAS 2225173-82-8) is a chemical compound with the molecular formula C11H15BBrNO2 and a molecular weight of 283.96 g/mol. IUPAC name: (2-bromo-6-cyclohexyl-4-pyridinyl)boronic acid. InChIKey: SXFCZWWPEDOUDA-UHFFFAOYSA-N.
| Molecular formula | C11H15BBrNO2 |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | (2-bromo-6-cyclohexyl-4-pyridinyl)boronic acid |
| InChIKey | SXFCZWWPEDOUDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)Br)C2CCCCC2)(O)O |
Computed by PubChem (NCBI)