CAS 452972-12-2 appears in our catalog under these names: 2-Bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 2-Bromo-3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridine, 98%, 98%, 2-Bromopyridine-3-boronic acid pinacol ester, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
2-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 452972-12-2) is a chemical compound with the molecular formula C11H15BBrNO2 and a molecular weight of 283.96 g/mol. IUPAC name: 2-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QAQDSIBZRCSYAR-UHFFFAOYSA-N.
| Molecular formula | C11H15BBrNO2 |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | 2-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QAQDSIBZRCSYAR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)Br |
Computed by PubChem (NCBI)