Products 2096339-22-7
CAS 2096339-22-7 appears in our catalog under these names: 6-(Propionyl)pyridine-3-boronic acid pinacol ester, 97%, 1-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)propan-1-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-one (CAS 2096339-22-7) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-one. InChIKey: ACESLJCSCAXFCL-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-1-one |
| InChIKey | ACESLJCSCAXFCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)CC |
Computed by PubChem (NCBI)