CAS 2096419-56-4 appears in our catalog under these names: 6,7-Dihydro-5H-cyclopenta(b)pyridine-2,5-diamine dihydrochloride, 95%, 6,7-Dihydro-5H-cyclopenta[b]pyridine-2,5-diamine dihydrochloride, 95%, 95%, 6,7-Dihydro-5H-cyclopenta[b]pyridine-2,5-diamine dihydrochloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg.
6,7-dihydro-5H-cyclopenta[b]pyridine-2,5-diamine;dihydrochloride (CAS 2096419-56-4) is a chemical compound with the molecular formula C8H13Cl2N3 and a molecular weight of 222.11 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[b]pyridine-2,5-diamine;dihydrochloride. InChIKey: JLTSXXBDUGSVFG-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2N3 |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[b]pyridine-2,5-diamine;dihydrochloride |
| InChIKey | JLTSXXBDUGSVFG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=N2)N.Cl.Cl |
Computed by PubChem (NCBI)