Products 2096459-08-2
CAS 2096459-08-2 appears in our catalog under these names: 2-(Tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine, 95%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo(1,2-a)pyridine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine (CAS 2096459-08-2) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine. InChIKey: GKDAMYHJOCAZFN-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
| InChIKey | GKDAMYHJOCAZFN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN3C=CC=CC3=N2 |
Computed by PubChem (NCBI)