CAS 2225169-54-8 is the registry number for 2–Chloro–4–(4–methylpiperidin–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[2-chloro-4-(4-methylpiperidin-1-yl)phenyl]boronic acid (CAS 2225169-54-8) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: [2-chloro-4-(4-methylpiperidin-1-yl)phenyl]boronic acid. InChIKey: FHMOSOFCWYNDFU-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | [2-chloro-4-(4-methylpiperidin-1-yl)phenyl]boronic acid |
| InChIKey | FHMOSOFCWYNDFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCC(CC2)C)Cl)(O)O |
Computed by PubChem (NCBI)