CAS 2097275-31-3 is the registry number for rel-Methyl 4-((1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzoate (CAS 2097275-31-3) is a chemical compound with the molecular formula C17H23BO4 and a molecular weight of 302.2 g/mol. IUPAC name: methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzoate. InChIKey: RFXMYRFJZANTGE-UHFFFAOYSA-N.
| Molecular formula | C17H23BO4 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | methyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzoate |
| InChIKey | RFXMYRFJZANTGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC2C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)