CAS 2097938-61-7 appears in our catalog under these names: 6-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 6-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 97%, 6–Methyl–1，2，3，4–tetrahydronaphthalen–1–amine hydrochloride, 6-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
6-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2097938-61-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 6-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: UYOOUVGXRQAUTM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 6-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | UYOOUVGXRQAUTM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(CCC2)N.Cl |
Computed by PubChem (NCBI)