CAS 2098034-12-7 is the registry number for 1-Isopropyl-3-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-2,4-dioxo-1-propan-2-ylpyrimidine-5-carbonitrile (CAS 2098034-12-7) is a chemical compound with the molecular formula C9H11N3O2 and a molecular weight of 193.20 g/mol. IUPAC name: 3-methyl-2,4-dioxo-1-propan-2-ylpyrimidine-5-carbonitrile. InChIKey: DQZLDGOFXISKDP-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-methyl-2,4-dioxo-1-propan-2-ylpyrimidine-5-carbonitrile |
| InChIKey | DQZLDGOFXISKDP-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=O)N(C1=O)C)C#N |
Computed by PubChem (NCBI)