Products 2098101-12-1
CAS 2098101-12-1 is the registry number for 1–(5–(3–aminopyrrolidine–1–carbonyl)thiophen–2–yl)ethan–1–one. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
1-[5-(3-aminopyrrolidine-1-carbonyl)thiophen-2-yl]ethanone (CAS 2098101-12-1) is a chemical compound with the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. IUPAC name: 1-[5-(3-aminopyrrolidine-1-carbonyl)thiophen-2-yl]ethanone. InChIKey: YGNPDFOAVUBMEL-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 1-[5-(3-aminopyrrolidine-1-carbonyl)thiophen-2-yl]ethanone |
| InChIKey | YGNPDFOAVUBMEL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C(=O)N2CCC(C2)N |
Computed by PubChem (NCBI)