CAS 2102168-48-7 is the registry number for tert-Butyl 5-cyano-1-oxo-3H-isoindole-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 6-cyano-3-oxo-1H-isoindole-2-carboxylate (CAS 2102168-48-7) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: tert-butyl 6-cyano-3-oxo-1H-isoindole-2-carboxylate. InChIKey: UVGDTERHRIDUDH-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | tert-butyl 6-cyano-3-oxo-1H-isoindole-2-carboxylate |
| InChIKey | UVGDTERHRIDUDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1=O)C=CC(=C2)C#N |
Computed by PubChem (NCBI)