Products 2665069-71-4
CAS 2665069-71-4 is the registry number for (7R)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol,oxalic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(7R)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid (CAS 2665069-71-4) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: (7R)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid. InChIKey: JVTWONPGZQKRTM-SGMQTFONSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | (7R)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-7-ol;oxalic acid |
| InChIKey | JVTWONPGZQKRTM-SGMQTFONSA-N |
| SMILES | C1CN2C[C@@H](CC2CN1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)