CAS 2102412-56-4 appears in our catalog under these names: 7-Fluoroquinoline-5-carboxylic acid, 98%, 98%, 7-FLUOROQUINOLINE-5-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-fluoroquinoline-5-carboxylic acid (CAS 2102412-56-4) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 7-fluoroquinoline-5-carboxylic acid. InChIKey: IKBSIXAQDQPMII-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 7-fluoroquinoline-5-carboxylic acid |
| InChIKey | IKBSIXAQDQPMII-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2N=C1)F)C(=O)O |
Computed by PubChem (NCBI)