Products 2102412-70-2
CAS 2102412-70-2 appears in our catalog under these names: (R)-3-Amino-5-methyl-2,3-dihydrobenzo(b)(1,4)oxazepin-4(5H)-one hydrochloride, 97+%, (3R)-3-Amino-5-methyl-2,3,4,5-tetrahydro-1,5-benzoxazepin-4-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
(3R)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride (CAS 2102412-70-2) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: (3R)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride. InChIKey: LGLCJIIJYYSZRU-OGFXRTJISA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | (3R)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one;hydrochloride |
| InChIKey | LGLCJIIJYYSZRU-OGFXRTJISA-N |
| SMILES | CN1C2=CC=CC=C2OC[C@H](C1=O)N.Cl |
Computed by PubChem (NCBI)