CAS 2103395-83-9 appears in our catalog under these names: (S)–1–(3–Methoxyphenyl)propan–1–amine hydrochloride, (1S)-1-(3-Methoxyphenyl)propylamine hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
(1S)-1-(3-methoxyphenyl)propan-1-amine;hydrochloride (CAS 2103395-83-9) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1S)-1-(3-methoxyphenyl)propan-1-amine;hydrochloride. InChIKey: MRMOMOWBZZIRBU-PPHPATTJSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1S)-1-(3-methoxyphenyl)propan-1-amine;hydrochloride |
| InChIKey | MRMOMOWBZZIRBU-PPHPATTJSA-N |
| SMILES | CC[C@@H](C1=CC(=CC=C1)OC)N.Cl |
Computed by PubChem (NCBI)