CAS 856562-95-3 appears in our catalog under these names: (R)-1-(3-Methoxyphenyl)propan-1-amine hydrochloride, 95%, 95%, (1R)-1-(3-Methoxyphenyl)propylamine hydrochloride, (1R)-1-(3-Methoxyphenyl)propylamine hydrochloride, 95%, (R)–1–(3–Methoxyphenyl)propan–1–amine hydrochloride, (R)-1-(3-Methoxyphenyl)propan-1-amine hydrochloride, 95%. Offered by: Chemat, Biosynth, Fluorochem, GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 2,5g.
(1R)-1-(3-methoxyphenyl)propan-1-amine;hydrochloride (CAS 856562-95-3) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1R)-1-(3-methoxyphenyl)propan-1-amine;hydrochloride. InChIKey: MRMOMOWBZZIRBU-HNCPQSOCSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1R)-1-(3-methoxyphenyl)propan-1-amine;hydrochloride |
| InChIKey | MRMOMOWBZZIRBU-HNCPQSOCSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)OC)N.Cl |
Computed by PubChem (NCBI)