Products 21041-10-1
CAS 21041-10-1 appears in our catalog under these names: Dihydronarwedine, Dihydro Galanthaminone, Dihydronarwedine, >95% (HPLC), rac-Dihydro Galantaminone HCl. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, on request, 25mg, 5mg, 25 mg, 10 mg, 5 mg.
(1R,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-one (CAS 21041-10-1) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: (1R,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-one. InChIKey: UFQNQEIAGBZCBL-YOEHRIQHSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | (1R,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9-trien-14-one |
| InChIKey | UFQNQEIAGBZCBL-YOEHRIQHSA-N |
| SMILES | CN1CC[C@@]23CCC(=O)C[C@@H]2OC4=C(C=CC(=C34)C1)OC |
Computed by PubChem (NCBI)