Products 210413-43-7
CAS 210413-43-7 is the registry number for 8,3′-Dihydroxy-7,4′-dimethoxyisoflavone. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one (CAS 210413-43-7) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one. InChIKey: WRBFKRCITGOZSZ-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one |
| InChIKey | WRBFKRCITGOZSZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3O)OC)O |
Computed by PubChem (NCBI)