CAS 2104659-22-3 is the registry number for tert-Butyl 3-(trifluoromethyl)-1H-pyrazole-5-carboxylate, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 50mg, 250mg.
Tert-butyl 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate (CAS 2104659-22-3) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: tert-butyl 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate. InChIKey: CVIWYSMAJDYIFH-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | tert-butyl 5-(trifluoromethyl)-1H-pyrazole-3-carboxylate |
| InChIKey | CVIWYSMAJDYIFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NNC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)