CAS 2104694-94-0 is the registry number for Ethyl 6-bromo-2,3-dihydro-7-methyl-1H-indene-4-carboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Ethyl 6-bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylate (CAS 2104694-94-0) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: ethyl 6-bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylate. InChIKey: BQFRNQHBPRKNQD-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | ethyl 6-bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylate |
| InChIKey | BQFRNQHBPRKNQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C2=C1CCC2)C)Br |
Computed by PubChem (NCBI)