Products 2104694-95-1

CAS 2104694-95-1 is the registry number for 6-Bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

6-bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylic acid (CAS 2104694-95-1) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 6-bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylic acid. InChIKey: BZUGEMZYVQAMCN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BrO2
Molecular weight255.11 g/mol
IUPAC name6-bromo-7-methyl-2,3-dihydro-1H-indene-4-carboxylic acid
InChIKeyBZUGEMZYVQAMCN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C2=C1CCC2)C(=O)O)Br

Computed by PubChem (NCBI)