CAS 2106-10-7 appears in our catalog under these names: a-D-Glucopyranosyl fluoride, (2R,3R,4S,5S,6R)-2-Fluoro-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol, 97%, 97%, a-D-Glucopyranosyl fluoride, 100 mg, a-D-Glucopyranosyl fluoride, 250 mg, a-D-Glucopyranosyl fluoride, 500 mg. Offered by: Biosynth, Chemat, Roth, Ambeed. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg, 100g, 1g, 5g.
(3R,4S,5S,6R)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 2106-10-7) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (3R,4S,5S,6R)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: ATMYEINZLWEOQU-GASJEMHNSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (3R,4S,5S,6R)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | ATMYEINZLWEOQU-GASJEMHNSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)F)O)O)O)O |
Computed by PubChem (NCBI)