CAS 18961-68-7 appears in our catalog under these names: (3R,4S,5R,6S)–6–(fluoromethyl)tetrahydro–2H–pyran–2,3,4,5–tetraol, 6-Deoxy-6-fluoro-D-galactopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 250mg, 500mg, 1g.
(3R,4S,5R,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol (CAS 18961-68-7) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (3R,4S,5R,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol. InChIKey: SHFYXYMHVMDNPY-SVZMEOIVSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (3R,4S,5R,6S)-6-(fluoromethyl)oxane-2,3,4,5-tetrol |
| InChIKey | SHFYXYMHVMDNPY-SVZMEOIVSA-N |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O)F |
Computed by PubChem (NCBI)