CAS 30694-44-1 appears in our catalog under these names: (3R,4R,5S,6R)–5–fluoro–6–(hydroxymethyl)tetrahydro–2H–pyran–2,3,4–triol, 4-Deoxy-4-fluoro-D-glucopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 50mg.
(3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)oxane-2,3,4-triol (CAS 30694-44-1) is a chemical compound with the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. IUPAC name: (3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)oxane-2,3,4-triol. InChIKey: FIHYONSINSKFAH-GASJEMHNSA-N.
| Molecular formula | C6H11FO5 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | (3R,4R,5S,6R)-5-fluoro-6-(hydroxymethyl)oxane-2,3,4-triol |
| InChIKey | FIHYONSINSKFAH-GASJEMHNSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)F)O |
Computed by PubChem (NCBI)