CAS 2109516-33-6 is the registry number for (1S,2R,3R,8S)-4-(((tert-Butoxycarbonyl)amino)methyl)cubane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cubane-1-carboxylic acid (CAS 2109516-33-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cubane-1-carboxylic acid. InChIKey: VYJBNPBOLKYHKL-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cubane-1-carboxylic acid |
| InChIKey | VYJBNPBOLKYHKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC12C3C4C1C5C2C3C45C(=O)O |
Computed by PubChem (NCBI)