Products 2109661-71-2
CAS 2109661-71-2 is the registry number for Methyl 2-(6-Chloro-3-pyridyl)-2-cyclopropylacetate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(6-chloro-3-pyridinyl)-2-cyclopropylacetate (CAS 2109661-71-2) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: methyl 2-(6-chloro-3-pyridinyl)-2-cyclopropylacetate. InChIKey: JHNJHELBCVAWSU-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | methyl 2-(6-chloro-3-pyridinyl)-2-cyclopropylacetate |
| InChIKey | JHNJHELBCVAWSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1CC1)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)