Products 2110414-04-3
CAS 2110414-04-3 is the registry number for Lenvatinib Impurity 149. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxybenzamide (CAS 2110414-04-3) is a chemical compound with the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. IUPAC name: 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxybenzamide. InChIKey: CMJDDBKDMDECIX-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O6 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-2-methoxybenzamide |
| InChIKey | CMJDDBKDMDECIX-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC(=C(C=C2)C(=O)N)OC)C(=O)O1)C |
Computed by PubChem (NCBI)