Products 73488-77-4

CAS 73488-77-4 is the registry number for Z-Dl-ala-osu, 98%. Offered by: Combi-blocks. Available pack sizes: 100g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2-(phenylmethoxycarbonylamino)propanoate (CAS 73488-77-4) is a chemical compound with the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-(phenylmethoxycarbonylamino)propanoate. InChIKey: OFIYNISEFIEQBC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16N2O6
Molecular weight320.30 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2-(phenylmethoxycarbonylamino)propanoate
InChIKeyOFIYNISEFIEQBC-UHFFFAOYSA-N
SMILESCC(C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)