Products 128595-77-7
CAS 128595-77-7 is the registry number for Diethyl 2-(cyano(4-nitrophenyl)methyl)malonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 2-[cyano-(4-nitrophenyl)methyl]propanedioate (CAS 128595-77-7) is a chemical compound with the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. IUPAC name: diethyl 2-[cyano-(4-nitrophenyl)methyl]propanedioate. InChIKey: AATUFLCASIZBAT-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O6 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | diethyl 2-[cyano-(4-nitrophenyl)methyl]propanedioate |
| InChIKey | AATUFLCASIZBAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C#N)C1=CC=C(C=C1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)