CAS 3401-36-3 appears in our catalog under these names: Z–Ala–OSu, Z-L-alanine-N-hydroxysuccinimide ester, Z-Ala-OSu 95%, Z-Ala-OSu, 95%, 95%, Z-Ala-OSu, 98.0%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 10g, 50g, 1g, 500g, 5g, 100 g.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)propanoate (CAS 3401-36-3) is a chemical compound with the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: OFIYNISEFIEQBC-JTQLQIEISA-N.
| Molecular formula | C15H16N2O6 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | OFIYNISEFIEQBC-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)