Products 144722-82-7
CAS 144722-82-7 appears in our catalog under these names: N-(2-(2-Oxoindolin-3-yl)acetyl)-Glu-OH, 95%, (2-(2-OXOINDOLIN-3-YL)ACETYL)-L-GLUTAMIC ACID, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]pentanedioic acid (CAS 144722-82-7) is a chemical compound with the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. IUPAC name: (2S)-2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]pentanedioic acid. InChIKey: LYVJMMKGNXWUHO-UMJHXOGRSA-N.
| Molecular formula | C15H16N2O6 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | (2S)-2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]pentanedioic acid |
| InChIKey | LYVJMMKGNXWUHO-UMJHXOGRSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)CC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)