Products 211230-67-0
CAS 211230-67-0 is the registry number for ONO-AE 248, 98.27%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 100 mg, 50 mg.
(Z)-7-[(1R,2R,3R)-3-methoxy-2-[(E,3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (CAS 211230-67-0) is a chemical compound with the molecular formula C22H36O5 and a molecular weight of 380.5 g/mol. IUPAC name: (Z)-7-[(1R,2R,3R)-3-methoxy-2-[(E,3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid. InChIKey: MXDQOCKVVLKVJS-QKIVIXBWSA-N.
| Molecular formula | C22H36O5 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,3R)-3-methoxy-2-[(E,3S)-3-methoxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | MXDQOCKVVLKVJS-QKIVIXBWSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)O)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
11,15-O-dimethyl-PGE2, orb1699759