CAS 211305-81-6 is the registry number for (R)-(-)-Coerulescine. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 5mg, 25mg.
(3R)-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one (CAS 211305-81-6) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: (3R)-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one. InChIKey: PNYGHERLKSFRMH-LBPRGKRZSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (3R)-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| InChIKey | PNYGHERLKSFRMH-LBPRGKRZSA-N |
| SMILES | CN1CC[C@]2(C1)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)