Products 2113085-63-3
CAS 2113085-63-3 is the registry number for methyl 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylate (CAS 2113085-63-3) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylate. InChIKey: WLFUEJKNXXLQFU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylate |
| InChIKey | WLFUEJKNXXLQFU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OC(=O)N2)C(=O)OC |
Computed by PubChem (NCBI)