CAS 2113174-02-8 is the registry number for Methyl 2,3-dimethyl-1-oxo-1,2-dihydroisoquinoline-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,3-dimethyl-1-oxoisoquinoline-7-carboxylate (CAS 2113174-02-8) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: methyl 2,3-dimethyl-1-oxoisoquinoline-7-carboxylate. InChIKey: HFVYUKINMKRQID-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | methyl 2,3-dimethyl-1-oxoisoquinoline-7-carboxylate |
| InChIKey | HFVYUKINMKRQID-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)C(=O)OC)C(=O)N1C |
Computed by PubChem (NCBI)