CAS 2114-63-8 appears in our catalog under these names: 2-((2,3-dimethylphenyl)(nitroso)amino)benzoic acid, N-2,3-Xylyl-N-nitrosoanthranilic Acid, N-NITROSO MEFENAMIC ACID. Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 250mg, 500mg, 50mg, 25MG.
2-(2,3-dimethyl-N-nitrosoanilino)benzoic acid (CAS 2114-63-8) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: 2-(2,3-dimethyl-N-nitrosoanilino)benzoic acid. InChIKey: YOLMDHKDPNUCER-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-(2,3-dimethyl-N-nitrosoanilino)benzoic acid |
| InChIKey | YOLMDHKDPNUCER-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N(C2=CC=CC=C2C(=O)O)N=O)C |
Computed by PubChem (NCBI)