CAS 211504-94-8 appears in our catalog under these names: Cypermethrin Impurity 7, θ-Cypermethrin 1-Epimeric Mixture. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 211504-94-8) is a chemical compound with the molecular formula C22H19Cl2NO3 and a molecular weight of 416.3 g/mol. IUPAC name: cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: KAATUXNTWXVJKI-NKUTVCTDSA-N.
| Molecular formula | C22H19Cl2NO3 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | KAATUXNTWXVJKI-NKUTVCTDSA-N |
| SMILES | CC1([C@H]([C@@H]1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)