Products 21160-40-7
CAS 21160-40-7 is the registry number for 1-(4-Bromophenyl)-1-hydroxypropan-2-one, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-bromophenyl)-1-hydroxypropan-2-one (CAS 21160-40-7) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 1-(4-bromophenyl)-1-hydroxypropan-2-one. InChIKey: CPKAAKNUOYCKDF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 1-(4-bromophenyl)-1-hydroxypropan-2-one |
| InChIKey | CPKAAKNUOYCKDF-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C1=CC=C(C=C1)Br)O |
Computed by PubChem (NCBI)