Products 211635-33-5
CAS 211635-33-5 is the registry number for (S)–4–(Amino(carboxy)methyl)cubane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g.
4-[(S)-amino(carboxy)methyl]cubane-1-carboxylic acid (CAS 211635-33-5) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4-[(S)-amino(carboxy)methyl]cubane-1-carboxylic acid. InChIKey: UVZLSWUNCANUPD-SBISGXONSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4-[(S)-amino(carboxy)methyl]cubane-1-carboxylic acid |
| InChIKey | UVZLSWUNCANUPD-SBISGXONSA-N |
| SMILES | C12C3C4C1(C5C2C3(C45)C(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)