Products 2116519-76-5
CAS 2116519-76-5 is the registry number for LW106. Offered by: MedChemExpress. Available pack sizes: Get quote.
(NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(1,3-dihydroisoindol-2-yl)methylidene]hydroxylamine (CAS 2116519-76-5) is a chemical compound with the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. IUPAC name: (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(1,3-dihydroisoindol-2-yl)methylidene]hydroxylamine. InChIKey: QHVIXMMITPHBSL-QBFSEMIESA-N.
| Molecular formula | C11H11N5O2 |
|---|---|
| Molecular weight | 245.24 g/mol |
| IUPAC name | (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(1,3-dihydroisoindol-2-yl)methylidene]hydroxylamine |
| InChIKey | QHVIXMMITPHBSL-QBFSEMIESA-N |
| SMILES | C1C2=CC=CC=C2CN1/C(=N\O)/C3=NON=C3N |
Computed by PubChem (NCBI)