Products 2117730-84-2
CAS 2117730-84-2 appears in our catalog under these names: 2-chloro-5-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)benzamide, 99%, 99%, GW9662-d5. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg.
2-chloro-5-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)benzamide (CAS 2117730-84-2) is a chemical compound with the molecular formula C13H9ClN2O3 and a molecular weight of 281.70 g/mol. IUPAC name: 2-chloro-5-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)benzamide. InChIKey: DNTSIBUQMRRYIU-RALIUCGRSA-N.
| Molecular formula | C13H9ClN2O3 |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 2-chloro-5-nitro-N-(2,3,4,5,6-pentadeuteriophenyl)benzamide |
| InChIKey | DNTSIBUQMRRYIU-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl)[2H])[2H] |
Computed by PubChem (NCBI)