CAS 2118245-00-2 is the registry number for Methoxetamine–d3 (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 500μg.
2-(ethylamino)-2-[3-(trideuteriomethoxy)phenyl]cyclohexan-1-one;hydrochloride (CAS 2118245-00-2) is a chemical compound with the molecular formula C15H22ClNO2 and a molecular weight of 286.81 g/mol. IUPAC name: 2-(ethylamino)-2-[3-(trideuteriomethoxy)phenyl]cyclohexan-1-one;hydrochloride. InChIKey: FJNRBMKLTGCSRN-MUTAZJQDSA-N.
| Molecular formula | C15H22ClNO2 |
|---|---|
| Molecular weight | 286.81 g/mol |
| IUPAC name | 2-(ethylamino)-2-[3-(trideuteriomethoxy)phenyl]cyclohexan-1-one;hydrochloride |
| InChIKey | FJNRBMKLTGCSRN-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1)C2(CCCCC2=O)NCC.Cl |
Computed by PubChem (NCBI)