Products 2121511-53-1
CAS 2121511-53-1 appears in our catalog under these names: 5-chloro-2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, ≥95%, 5-Chloro-2-ethoxypyridine-3-boronic acid pinacol ester, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
5-chloro-2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121511-53-1) is a chemical compound with the molecular formula C13H19BClNO3 and a molecular weight of 283.56 g/mol. IUPAC name: 5-chloro-2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XOOIQGCESLKEKD-UHFFFAOYSA-N.
| Molecular formula | C13H19BClNO3 |
|---|---|
| Molecular weight | 283.56 g/mol |
| IUPAC name | 5-chloro-2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XOOIQGCESLKEKD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2OCC)Cl |
Computed by PubChem (NCBI)