Products 212202-81-8
CAS 212202-81-8 is the registry number for 1,2-Dihydro-2-(4-methylphenyl)-3H-1,2,4-triazol-3-one, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
2-(4-methylphenyl)-4H-1,2,4-triazol-3-one (CAS 212202-81-8) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 2-(4-methylphenyl)-4H-1,2,4-triazol-3-one. InChIKey: SXFMDUOTGIZGCG-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 2-(4-methylphenyl)-4H-1,2,4-triazol-3-one |
| InChIKey | SXFMDUOTGIZGCG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)NC=N2 |
Computed by PubChem (NCBI)