CAS 212580-10-4 is the registry number for 1-Carboxy-3-methacryloyloxyadamantane. Offered by: TRC. Available pack sizes: 2,5g.
3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid (CAS 212580-10-4) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid. InChIKey: BJGCYZMFJALKRF-UHFFFAOYSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid |
| InChIKey | BJGCYZMFJALKRF-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC12CC3CC(C1)CC(C3)(C2)C(=O)O |
Computed by PubChem (NCBI)