Products 2126161-86-0
CAS 2126161-86-0 is the registry number for Ethyl 2-amino-3,3,3-trifluoro-2-phenylpropanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Ethyl 2-amino-3,3,3-trifluoro-2-phenylpropanoate;hydrochloride (CAS 2126161-86-0) is a chemical compound with the molecular formula C11H13ClF3NO2 and a molecular weight of 283.67 g/mol. IUPAC name: ethyl 2-amino-3,3,3-trifluoro-2-phenylpropanoate;hydrochloride. InChIKey: JYMYDTORAQSPMN-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO2 |
|---|---|
| Molecular weight | 283.67 g/mol |
| IUPAC name | ethyl 2-amino-3,3,3-trifluoro-2-phenylpropanoate;hydrochloride |
| InChIKey | JYMYDTORAQSPMN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)