CAS 2126161-93-9 is the registry number for N-(4-(Aminomethyl)phenyl)cyclopropanecarboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[4-(aminomethyl)phenyl]cyclopropanecarboxamide;hydrochloride (CAS 2126161-93-9) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: N-[4-(aminomethyl)phenyl]cyclopropanecarboxamide;hydrochloride. InChIKey: NHUHNDXMEDECBV-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | N-[4-(aminomethyl)phenyl]cyclopropanecarboxamide;hydrochloride |
| InChIKey | NHUHNDXMEDECBV-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)