Products 2126163-29-7
CAS 2126163-29-7 is the registry number for 1H,2H,3H,4H-Cyclopenta(b)indole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg.
1,2,3,4-tetrahydrocyclopenta[b]indole-5-carbonitrile (CAS 2126163-29-7) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 1,2,3,4-tetrahydrocyclopenta[b]indole-5-carbonitrile. InChIKey: HPNXQWCWQODQHT-UHFFFAOYSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 1,2,3,4-tetrahydrocyclopenta[b]indole-5-carbonitrile |
| InChIKey | HPNXQWCWQODQHT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)NC3=C(C=CC=C23)C#N |
Computed by PubChem (NCBI)